CAS 851386-43-1

2,5-Difluoro-3-pyridinecarboxylic acid

Description:

2,5-Difluoro-3-pyridinecarboxylic acid is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with two fluorine atoms and a carboxylic acid group. The fluorine substituents are located at the 2 and 5 positions of the pyridine ring, while the carboxylic acid group is situated at the 3 position. This compound exhibits polar characteristics due to the carboxylic acid functional group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The presence of fluorine atoms contributes to its unique electronic properties, potentially influencing its reactivity and interactions with biological systems. 2,5-Difluoro-3-pyridinecarboxylic acid may be utilized in various applications, including pharmaceuticals and agrochemicals, due to its potential as a building block in the synthesis of more complex molecules. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the molecular structure and the environment in which it is used.

Formula: C₆H₃F₂NO₂

InChI: InChI=1S/C6H3F2NO2/c7-3-1-4(6(10)11)5(8)9-2-3/h1-2H,(H,10,11)

InChI key: InChIKey=NEDDADJKOLQIJZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(F)N=CC(F)=C1

Synonyms:

• 2,5-Difluoro Nicotinic Acid
• 2,5-Difluoro-3-pyridinecarboxylic acid
• 2,5-Difluoronicotinic acid
• 3-Pyridinecarboxylic acid, 2,5-difluoro-
• 2,5-Difluoropyridine-3-carboxylic acid

2,5-Difluoronicotinic acid

CAS: 851386-43-1

Formula: C₆H₃F₂NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 159.0903

Ref: IN-DA004QSF

2,5-Difluoronicotinic acid

CAS: 851386-43-1

2,5-Difluoronicotinic acid

Purity: 97%

Molecular weight: 159.091g/mol

Ref: 54-PC103945

2,5-Difluoro-nicotinic acid

CAS: 851386-43-1

Formula: C₆H₃F₂NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 159.092

Ref: 10-F032887