
CAS 851398-32-8
:Acetamide, 2-chloro-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-
Description:
Acetamide, 2-chloro-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]- is a chemical compound characterized by its acetamide functional group, which features an amide linkage where the nitrogen is bonded to an acetyl group. The presence of a chloro substituent indicates that chlorine is attached to the carbon chain, influencing the compound's reactivity and polarity. The structure includes a 2,3-dihydro-1,4-benzodioxin moiety, which contributes to its aromatic characteristics and may affect its biological activity. This compound is likely to exhibit moderate solubility in polar solvents due to the amide group, while the benzodioxin structure may impart hydrophobic properties. Its potential applications could span various fields, including pharmaceuticals and agrochemicals, depending on its biological activity and interaction with biological systems. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the chlorine atom, which can pose hazards in certain contexts.
Formula:C12H14ClNO3
InChI:InChI=1S/C12H14ClNO3/c1-8(14-12(15)7-13)9-2-3-10-11(6-9)17-5-4-16-10/h2-3,6,8H,4-5,7H2,1H3,(H,14,15)
InChI key:InChIKey=BSXDSGTXOJSUAH-UHFFFAOYSA-N
SMILES:C(NC(CCl)=O)(C)C=1C=C2C(=CC1)OCCO2
Synonyms:- Acetamide, 2-chloro-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-
- 2-Chloro-N-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.