CAS 851468-03-6
:2-[[1-(2,3-Dimethylphenyl)-1H-imidazol-2-yl]thio]acetic acid
Description:
2-[[1-(2,3-Dimethylphenyl)-1H-imidazol-2-yl]thio]acetic acid is a chemical compound characterized by its unique structure, which includes an imidazole ring and a thioether linkage. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it potentially useful in various chemical applications, including medicinal chemistry. The presence of the dimethylphenyl group contributes to its hydrophobic characteristics, while the imidazole moiety may impart biological activity, possibly influencing interactions with biological targets. The thioacetic acid portion suggests that it may participate in redox reactions or serve as a precursor for further chemical modifications. As with many compounds containing sulfur, it may exhibit distinct reactivity patterns compared to their oxygen-containing analogs. Overall, this compound's structural features suggest potential utility in pharmaceutical development, particularly in the design of novel therapeutic agents. However, specific biological activities and applications would require further investigation through empirical studies.
Formula:C13H14N2O2S
InChI:InChI=1S/C13H14N2O2S/c1-9-4-3-5-11(10(9)2)15-7-6-14-13(15)18-8-12(16)17/h3-7H,8H2,1-2H3,(H,16,17)
InChI key:InChIKey=YDBMGVOTDPAKGU-UHFFFAOYSA-N
SMILES:S(CC(O)=O)C=1N(C=CN1)C2=C(C)C(C)=CC=C2
Synonyms:- 2-[[1-(2,3-Dimethylphenyl)-1H-imidazol-2-yl]thio]acetic acid
- Acetic acid, [[1-(2,3-dimethylphenyl)-1H-imidazol-2-yl]thio]-
- Acetic acid, 2-[[1-(2,3-dimethylphenyl)-1H-imidazol-2-yl]thio]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.