CymitQuimica logo

CAS 851468-09-2

:

5-Chloro-1,3-dihydro-1-(2-methylpropyl)-2H-benzimidazole-2-thione

Description:
5-Chloro-1,3-dihydro-1-(2-methylpropyl)-2H-benzimidazole-2-thione is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a chlorine atom and a thione functional group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the benzimidazole moiety, which is known for its applications in pharmaceuticals. The thione group contributes to its reactivity and may influence its solubility and stability in various solvents. The presence of the 2-methylpropyl substituent can affect the compound's lipophilicity and overall pharmacokinetic properties. As with many benzimidazole derivatives, this compound may exhibit antimicrobial, antifungal, or anti-inflammatory activities, making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods and can vary based on purity and environmental conditions.
Formula:C11H13ClN2S
InChI:InChI=1S/C11H13ClN2S/c1-7(2)6-14-10-4-3-8(12)5-9(10)13-11(14)15/h3-5,7H,6H2,1-2H3,(H,13,15)
InChI key:InChIKey=QSEPLPNAUQAMQQ-UHFFFAOYSA-N
SMILES:C(C(C)C)N1C=2C(NC1=S)=CC(Cl)=CC2
Synonyms:
  • 5-Chloro-1,3-dihydro-1-(2-methylpropyl)-2H-benzimidazole-2-thione
  • 2H-Benzimidazole-2-thione, 5-chloro-1,3-dihydro-1-(2-methylpropyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.