CymitQuimica logo

CAS 851472-82-7

:

1-[bis(4-fluorophenyl)methyl]-4-(4-nitrophenyl)piperazine

Description:
1-[Bis(4-fluorophenyl)methyl]-4-(4-nitrophenyl)piperazine is a chemical compound characterized by its complex structure, which includes a piperazine ring substituted with both a bis(4-fluorophenyl)methyl group and a 4-nitrophenyl group. This compound typically exhibits properties associated with piperazine derivatives, such as potential biological activity, which may include interactions with neurotransmitter systems. The presence of fluorine atoms in the phenyl groups can enhance lipophilicity and influence the compound's pharmacokinetic properties. Additionally, the nitro group is known to impart specific reactivity and can affect the compound's overall stability and solubility. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders. However, detailed studies on its biological activity, toxicity, and environmental impact would be necessary to fully understand its characteristics and potential uses. As with any chemical substance, proper handling and safety measures should be observed due to the presence of reactive functional groups.
Formula:C23H21F2N3O2
InChI:InChI=1/C23H21F2N3O2/c24-19-5-1-17(2-6-19)23(18-3-7-20(25)8-4-18)27-15-13-26(14-16-27)21-9-11-22(12-10-21)28(29)30/h1-12,23H,13-16H2
SMILES:c1cc(ccc1C(c1ccc(cc1)F)N1CCN(CC1)c1ccc(cc1)N(=O)=O)F
Synonyms:
  • Piperazine, 1-[Bis(4-Fluorophenyl)Methyl]-4-(4-Nitrophenyl)-
  • 1-[Bis(4-fluorophenyl)methyl]-4-(4-nitrophenyl)piperazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.