
CAS 851526-88-0
:6-(Phenylmethyl)-2,6-diazabicyclo[3.2.0]heptane
Description:
6-(Phenylmethyl)-2,6-diazabicyclo[3.2.0]heptane, identified by its CAS number 851526-88-0, is a bicyclic organic compound characterized by its unique structure, which includes a bicyclo[3.2.0] framework and two nitrogen atoms incorporated into the ring system. This compound features a phenylmethyl group, which contributes to its aromatic properties and potential interactions in biological systems. The presence of the diazabicyclic structure suggests that it may exhibit interesting chemical reactivity and stability, making it a subject of interest in medicinal chemistry and drug design. Its nitrogen atoms can participate in hydrogen bonding and coordination with metal ions, potentially influencing its solubility and bioactivity. The compound's specific physical properties, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the environment in which it is studied. Overall, 6-(Phenylmethyl)-2,6-diazabicyclo[3.2.0]heptane represents a fascinating example of bicyclic nitrogen-containing compounds with potential applications in various fields of chemistry and pharmacology.
Formula:C12H16N2
InChI:InChI=1S/C12H16N2/c1-2-4-10(5-3-1)8-14-9-11-12(14)6-7-13-11/h1-5,11-13H,6-9H2
InChI key:InChIKey=YCEMQEOVBUUXAV-UHFFFAOYSA-N
SMILES:C(N1C2C(C1)NCC2)C3=CC=CC=C3
Synonyms:- 6-(Phenylmethyl)-2,6-diazabicyclo[3.2.0]heptane
- 2,6-Diazabicyclo[3.2.0]heptane, 6-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.