CAS 85153-51-1

Methyl 2-amino-α-(hydroxyimino)-4-thiazoleacetate

Description:

Methyl 2-amino-α-(hydroxyimino)-4-thiazoleacetate, with the CAS number 85153-51-1, is a chemical compound that features a thiazole ring, an amino group, and a hydroxyimino functional group. This compound is characterized by its potential biological activity, particularly in the realm of pharmaceuticals, where thiazole derivatives are often explored for their antimicrobial and anti-inflammatory properties. The presence of the amino and hydroxyimino groups suggests that it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the methyl ester functionality indicates that it can undergo hydrolysis to release the corresponding acid, which may enhance its solubility and bioavailability. The compound's structural features contribute to its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. As with many thiazole derivatives, it may exhibit a range of pharmacological effects, although specific biological activities would require further investigation through experimental studies.

Formula: C₆H₇N₃O₃S

InChI: InChI=1S/C6H7N3O3S/c1-12-5(10)4(9-11)3-2-13-6(7)8-3/h2,11H,1H3,(H2,7,8)

InChI key: InChIKey=PLRLPASADYABSQ-UHFFFAOYSA-N

SMILES: C(C(OC)=O)(=NO)C=1N=C(N)SC1

Synonyms:

• 4-Thiazoleacetic acid, 2-amino-α-(hydroxyimino)-, methyl ester
• Methyl 2-amino-α-(hydroxyimino)-4-thiazoleacetate