CAS 85153-60-2
:2-Butenoic acid, 4-chloro-3-methoxy-, methyl ester
Description:
2-Butenoic acid, 4-chloro-3-methoxy-, methyl ester, with the CAS number 85153-60-2, is an organic compound characterized by its ester functional group, which is derived from the reaction of 2-butenoic acid and methanol. This compound features a butenoic acid backbone, indicating the presence of a double bond between carbon atoms, which contributes to its reactivity and potential applications in organic synthesis. The presence of a chlorine atom at the 4-position and a methoxy group at the 3-position on the butenoic acid chain introduces unique electronic and steric properties, influencing its behavior in chemical reactions. Typically, such compounds may exhibit moderate polarity due to the ester and methoxy groups, affecting their solubility in various solvents. Additionally, the presence of the double bond may allow for further functionalization through addition reactions. Overall, this compound may find applications in fields such as pharmaceuticals, agrochemicals, or as intermediates in organic synthesis, although specific applications would depend on its reactivity and stability under various conditions.
Formula:C6H9ClO3
InChI:InChI=1S/C6H9ClO3/c1-9-5(4-7)3-6(8)10-2/h3H,4H2,1-2H3
InChI key:InChIKey=JNYMRXDQVPIONI-UHFFFAOYSA-N
SMILES:C(=CC(OC)=O)(CCl)OC
Synonyms:- 2-Butenoic acid, 4-chloro-3-methoxy-, methyl ester
- Methyl 4-chloro-3-methoxycrotonate
- Methyl 4-chloro-3-methoxy-2-butenoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
