CAS 85157-21-7

7-Amino-4-carboxymethylcoumarin

Description:

7-Amino-4-carboxymethylcoumarin is a synthetic compound belonging to the coumarin family, characterized by its unique bicyclic structure that includes a benzopyrone moiety. This compound features an amino group and a carboxymethyl group, which contribute to its solubility and reactivity. It is often used in biochemical applications, particularly as a fluorescent probe due to its ability to emit light upon excitation, making it valuable in various assays and imaging techniques. The presence of the amino and carboxymethyl groups enhances its functionality, allowing for potential interactions with biological molecules. Additionally, 7-Amino-4-carboxymethylcoumarin can be utilized in the synthesis of other chemical derivatives, expanding its utility in research and development. Its properties, such as stability, solubility in polar solvents, and fluorescence characteristics, make it a versatile tool in both organic chemistry and biochemistry. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₁H₉NO₄

InChI: InChI=1/C11H9NO4/c12-7-1-2-8-6(3-10(13)14)4-11(15)16-9(8)5-7/h1-2,4-5H,3,12H2,(H,13,14)

SMILES: c1cc2c(CC(=O)O)cc(=O)oc2cc1N

Synonyms:

• (7-Amino-2-oxo-2H-chromen-4-yl)acetic acid
• (7-Amino-2-oxo-2H-chromen-4-yl)-aceticacid
• 2H-1-benzopyran-4-acetic acid, 7-amino-2-oxo-
• 7-Amino-4-carboxymethyl coumarin

2H-​1-​Benzopyran-​4-​acetic acid, 7-​amino-​2-​oxo-

CAS: 85157-21-7

Formula: C₁₁H₉NO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 219.1935

Ref: IN-DA008G4C

2-(7-Amino-2-oxo-2H-chromen-4-yl)acetic acid

CAS: 85157-21-7

2-(7-Amino-2-oxo-2H-chromen-4-yl)acetic acid

Purity: 97%

Molecular weight: 219.19g/mol

Ref: 54-OR93851

2-(7-Amino-2-oxo-2H-chromen-4-yl)acetic Acid

Controlled Product

CAS: 85157-21-7

Applications 2-(7-Amino-2-oxo-2H-chromen-4-yl)acetic acid (cas# 85157-21-7) is a useful research chemical.

Formula: C₁₁H₉NO₄

Color and Shape: Neat

Molecular weight: 219.19

Ref: TR-A618838

(7-Amino-2-oxo-2H-chromen-4-yl)acetic acid

CAS: 85157-21-7

Formula: C₁₁H₉NO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 219.196

Ref: 10-F093071