CAS 85157-92-2

1-(4-methoxyphenyl)-3,3-dimethylbutan-1-one

Description:

1-(4-Methoxyphenyl)-3,3-dimethylbutan-1-one, also known by its CAS number 85157-92-2, is an organic compound characterized by its ketone functional group and a substituted aromatic ring. This compound features a methoxy group (-OCH3) attached to a para position of a phenyl ring, which influences its chemical reactivity and solubility. The presence of the bulky 3,3-dimethylbutan-1-one moiety contributes to its steric properties, potentially affecting its interactions in various chemical environments. Typically, compounds of this nature exhibit moderate to low volatility and may have a relatively high boiling point due to their molecular weight and structure. They are often used in organic synthesis and may serve as intermediates in the production of pharmaceuticals or other fine chemicals. Additionally, the methoxy group can enhance the compound's lipophilicity, influencing its behavior in biological systems. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₁₃H₁₈O₂

InChI: InChI=1/C13H18O2/c1-13(2,3)9-12(14)10-5-7-11(15-4)8-6-10/h5-8H,9H2,1-4H3

SMILES: CC(C)(C)CC(=O)c1ccc(cc1)OC

Synonyms:

• 1-(4-Methoxyphenyl)-3,3-dimethylbutane-1-one