CymitQuimica logo

CAS 851607-27-7

:

5-bromo-4-chloro-2-methoxypyridine

Description:
5-Bromo-4-chloro-2-methoxypyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of bromine and chlorine substituents at the 5 and 4 positions, respectively, introduces significant reactivity and influences its chemical properties. The methoxy group (-OCH3) at the 2 position enhances its solubility in organic solvents and can participate in various chemical reactions, such as nucleophilic substitutions. This compound is typically used in pharmaceutical research and development due to its potential biological activity, particularly in the synthesis of various bioactive molecules. Its molecular structure contributes to its unique properties, including its ability to act as a ligand in coordination chemistry and its role in various organic synthesis pathways. Additionally, the presence of halogens can affect its electronic properties, making it a valuable intermediate in the synthesis of more complex compounds. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.
Formula:C6H5BrClNO
InChI:InChI=1/C6H5BrClNO/c1-10-6-2-5(8)4(7)3-9-6/h2-3H,1H3
InChI key:KTPLBYFKHPABLJ-UHFFFAOYSA-N
SMILES:COc1cc(c(cn1)Br)Cl
Synonyms:
  • Pyridine, 5-bromo-4-chloro-2-methoxy-
Found 5 products.