CAS 85162-11-4
:[2-(4-fluorophenyl)-5-thiophen-3-yl-1,3-oxazol-4-yl]acetic acid
Description:
[2-(4-fluorophenyl)-5-thiophen-3-yl-1,3-oxazol-4-yl]acetic acid, with the CAS number 85162-11-4, is a chemical compound characterized by its unique structural features, which include an oxazole ring, a thiophene moiety, and a fluorophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the fluorine atom may enhance lipophilicity and influence the compound's interaction with biological targets. As an acetic acid derivative, it possesses acidic properties, which can affect its solubility and reactivity in various environments. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with specific biological pathways. Additionally, its stability and reactivity can be influenced by the substituents on the aromatic rings, making it a subject of interest for further research in organic synthesis and drug development.
Formula:C15H10FNO3S
InChI:InChI=1/C15H10FNO3S/c16-11-3-1-9(2-4-11)15-17-12(7-13(18)19)14(20-15)10-5-6-21-8-10/h1-6,8H,7H2,(H,18,19)
SMILES:c1cc(ccc1c1nc(CC(=O)O)c(c2ccsc2)o1)F
Synonyms:- 4-Oxazoleacetic Acid, 2-(4-Fluorophenyl)-5-(3-Thienyl)-
- [2-(4-fluorophenyl)-5-(thiophen-3-yl)-1,3-oxazol-4-yl]acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.