CAS 851628-34-7

4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]butanoic acid

Description:

4-[3-(4-Methylphenyl)-1,2,4-oxadiazol-5-yl]butanoic acid, with the CAS number 851628-34-7, is a chemical compound characterized by its unique structure that includes a butanoic acid moiety and a 1,2,4-oxadiazole ring substituted with a 4-methylphenyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical and material science research. The presence of the oxadiazole ring suggests possible applications in medicinal chemistry, particularly in the development of anti-inflammatory or analgesic agents. Additionally, the butanoic acid component may contribute to its interaction with biological systems. The compound's stability, reactivity, and specific interactions would depend on its molecular structure and the functional groups present, which could influence its behavior in various chemical environments. Overall, this compound represents a class of organic molecules that may have significant implications in drug discovery and development.

Formula: C₁₃H₁₄N₂O₃

InChI: InChI=1/C13H14N2O3/c1-9-5-7-10(8-6-9)13-14-11(18-15-13)3-2-4-12(16)17/h5-8H,2-4H2,1H3,(H,16,17)

SMILES: Cc1ccc(cc1)c1nc(CCCC(=O)O)on1

Synonyms:

• 1,2,4-Oxadiazole-5-Butanoic Acid, 3-(4-Methylphenyl)-