CymitQuimica logo

CAS 85169-25-1

:

N-[3-[(Phenylamino)sulfonyl]phenyl]acetamide

Description:
N-[3-[(Phenylamino)sulfonyl]phenyl]acetamide, with the CAS number 85169-25-1, is a chemical compound characterized by its sulfonamide functional group, which is known for its biological activity, particularly in medicinal chemistry. This compound features an acetamide moiety linked to a phenyl group that is further substituted with a sulfonyl group attached to another phenyl ring. The presence of the sulfonamide group often imparts properties such as increased solubility in polar solvents and potential interactions with biological targets, making it of interest in pharmaceutical research. The compound may exhibit various biological activities, including anti-inflammatory or antimicrobial effects, depending on its specific structure and substituents. Its molecular structure suggests potential for hydrogen bonding and dipole-dipole interactions, which can influence its reactivity and solubility. As with many sulfonamides, it may also be subject to specific regulatory considerations due to its potential therapeutic applications. Overall, N-[3-[(Phenylamino)sulfonyl]phenyl]acetamide represents a class of compounds with significant relevance in drug development and chemical research.
Formula:C14H14N2O3S
InChI:InChI=1S/C14H14N2O3S/c1-11(17)15-13-8-5-9-14(10-13)20(18,19)16-12-6-3-2-4-7-12/h2-10,16H,1H3,(H,15,17)
InChI key:InChIKey=VCVHGNYXAKLDLO-UHFFFAOYSA-N
SMILES:S(NC1=CC=CC=C1)(=O)(=O)C2=CC(NC(C)=O)=CC=C2
Synonyms:
  • Acetamide, N-[3-[(phenylamino)sulfonyl]phenyl]-
  • N-[3-[(Phenylamino)sulfonyl]phenyl]acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.