CAS 851721-87-4

7-Methyl-2-(2-thienyl)imidazo[1,2-a]pyridin-3-amine

Description:

7-Methyl-2-(2-thienyl)imidazo[1,2-a]pyridin-3-amine is a heterocyclic organic compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine core fused with a thienyl group and a methyl substituent. This compound typically exhibits properties associated with heterocycles, such as potential biological activity and solubility in organic solvents. The presence of nitrogen atoms in the imidazole and pyridine rings contributes to its basicity and potential for forming coordination complexes. Additionally, the thienyl group can influence the compound's electronic properties and reactivity. It may be of interest in medicinal chemistry due to its structural features, which can be associated with various pharmacological activities. The compound's CAS number, 851721-87-4, allows for easy identification in chemical databases, facilitating research and development in fields such as drug discovery and material science. Overall, this compound represents a unique scaffold that may be explored for its potential applications in various chemical and biological contexts.

Formula: C₁₂H₁₁N₃S

InChI: InChI=1S/C12H11N3S/c1-8-4-5-15-10(7-8)14-11(12(15)13)9-3-2-6-16-9/h2-7H,13H2,1H3

InChI key: InChIKey=RWCXUFFPULHMEE-UHFFFAOYSA-N

SMILES: NC1=C(N=C2N1C=CC(C)=C2)C3=CC=CS3

Synonyms:

• Imidazo[1,2-a]pyridin-3-amine, 7-methyl-2-(2-thienyl)-
• 7-Methyl-2-(2-thienyl)imidazo[1,2-a]pyridin-3-amine