
CAS 851721-94-3
:Ethyl 5-methyl-2-[(2-phenylethyl)amino]-4-thiazolecarboxylate
Description:
Ethyl 5-methyl-2-[(2-phenylethyl)amino]-4-thiazolecarboxylate, with the CAS number 851721-94-3, is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of a 5-methyl group and a 2-phenylethyl amino group enhances its potential for biological activity, possibly influencing its pharmacological properties. Thiazole derivatives are often studied for their antimicrobial, anti-inflammatory, and anticancer activities, making this compound of interest in medicinal chemistry. Its molecular structure suggests it may interact with various biological targets, although specific activity would depend on further empirical studies. The compound is likely to be a solid at room temperature, with properties such as melting point and boiling point that would need to be determined experimentally. Safety data, including toxicity and handling precautions, should be referenced from material safety data sheets (MSDS) or relevant literature before use.
Formula:C15H18N2O2S
InChI:InChI=1S/C15H18N2O2S/c1-3-19-14(18)13-11(2)20-15(17-13)16-10-9-12-7-5-4-6-8-12/h4-8H,3,9-10H2,1-2H3,(H,16,17)
InChI key:InChIKey=PWMKNXQNIPVSRQ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1N=C(NCCC2=CC=CC=C2)SC1C
Synonyms:- Ethyl 5-methyl-2-[(2-phenylethyl)amino]-4-thiazolecarboxylate
- 4-Thiazolecarboxylic acid, 5-methyl-2-[(2-phenylethyl)amino]-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.