
CAS 851721-99-8
:2-Chloro-N-[3-(4-methylphenyl)-5-isoxazolyl]acetamide
Description:
2-Chloro-N-[3-(4-methylphenyl)-5-isoxazolyl]acetamide, with the CAS number 851721-99-8, is a chemical compound characterized by its unique structural features, including a chloro group and an isoxazole ring. This compound typically exhibits properties associated with both amides and heterocycles, which can influence its reactivity and solubility. The presence of the chloro substituent may enhance its electrophilic character, making it potentially useful in various chemical reactions. The isoxazole moiety contributes to its biological activity, as compounds containing this functional group are often investigated for pharmacological properties. Additionally, the aromatic 4-methylphenyl group can affect the compound's lipophilicity and interaction with biological targets. Overall, this compound's characteristics suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C12H11ClN2O2
InChI:InChI=1S/C12H11ClN2O2/c1-8-2-4-9(5-3-8)10-6-12(17-15-10)14-11(16)7-13/h2-6H,7H2,1H3,(H,14,16)
InChI key:InChIKey=CJEVXSPSAAIOBM-UHFFFAOYSA-N
SMILES:N(C(CCl)=O)C1=CC(=NO1)C2=CC=C(C)C=C2
Synonyms:- 2-Chloro-N-[3-(4-methylphenyl)-5-isoxazolyl]acetamide
- Acetamide, 2-chloro-N-[3-(4-methylphenyl)-5-isoxazolyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.