CAS 851722-08-2

1-[2-[(4-Methylphenyl)amino]-2-oxoethyl]cyclopentanecarboxylic acid

Description:

1-[2-[(4-Methylphenyl)amino]-2-oxoethyl]cyclopentanecarboxylic acid, with the CAS number 851722-08-2, is a chemical compound characterized by its unique structure that includes a cyclopentanecarboxylic acid moiety and an amine group attached to a phenyl ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of both an amine and a carboxylic acid functional group, which can participate in various chemical reactions, including esterification and amidation. The presence of the 4-methylphenyl group suggests that it may have hydrophobic characteristics, influencing its interaction with biological systems. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its specific applications and behavior in biological systems would depend on further studies, including its pharmacokinetics and mechanism of action. Overall, this compound represents a class of organic molecules that may have significant implications in medicinal chemistry and drug development.

Formula: C₁₅H₁₉NO₃

InChI: InChI=1S/C15H19NO3/c1-11-4-6-12(7-5-11)16-13(17)10-15(14(18)19)8-2-3-9-15/h4-7H,2-3,8-10H2,1H3,(H,16,17)(H,18,19)

InChI key: InChIKey=ZZWGUDYANPFSHY-UHFFFAOYSA-N

SMILES: C(C(NC1=CC=C(C)C=C1)=O)C2(C(O)=O)CCCC2

Synonyms:

• Cyclopentanecarboxylic acid, 1-[2-[(4-methylphenyl)amino]-2-oxoethyl]-
• 1-[2-[(4-Methylphenyl)amino]-2-oxoethyl]cyclopentanecarboxylic acid

1-{[(4-Methylphenyl)carbamoyl]methyl}cyclopentane-1-carboxylic acid

CAS: 851722-08-2

Versatile small molecule scaffold

Formula: C₁₅H₁₉NO₃

Purity: Min. 95%

Molecular weight: 261.32 g/mol

Ref: 3D-BJB72208