CymitQuimica logo

CAS 851722-10-6

:

N-[4-(2-Amino-4-thiazolyl)phenyl]-2-methylpropanamide

Description:
N-[4-(2-Amino-4-thiazolyl)phenyl]-2-methylpropanamide, identified by its CAS number 851722-10-6, is a chemical compound characterized by its specific structural features, including an amide functional group and a thiazole moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its solubility, stability, and reactivity. The presence of the amino group suggests potential for hydrogen bonding, which can affect its interaction with biological targets. Additionally, the thiazole ring contributes to its pharmacological profile, as thiazole derivatives are often found in various bioactive compounds. The compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development or as a biochemical probe. Its synthesis and characterization would involve standard organic chemistry techniques, and its behavior in biological systems would require further investigation through pharmacological studies. Overall, this compound represents a unique combination of structural elements that may confer specific biological activities.
Formula:C13H15N3OS
InChI:InChI=1S/C13H15N3OS/c1-8(2)12(17)15-10-5-3-9(4-6-10)11-7-18-13(14)16-11/h3-8H,1-2H3,(H2,14,16)(H,15,17)
InChI key:InChIKey=CFHVOJFDCFPNCN-UHFFFAOYSA-N
SMILES:NC1=NC(C2=CC=C(NC(C(C)C)=O)C=C2)=CS1
Synonyms:
  • N-[4-(2-Amino-4-thiazolyl)phenyl]-2-methylpropanamide
  • Propanamide, N-[4-(2-amino-4-thiazolyl)phenyl]-2-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.