CAS 851756-53-1

B-(2,3,6-Trichlorophenyl)boronic acid

Description:

B-(2,3,6-Trichlorophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a trichlorophenyl moiety. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents, such as methanol and dimethyl sulfoxide, while being less soluble in non-polar solvents. The presence of multiple chlorine atoms on the phenyl ring enhances its reactivity and can influence its electronic properties, making it useful in various chemical applications, including cross-coupling reactions in organic synthesis. Boronic acids are known for their ability to form reversible complexes with diols, which is a key feature in applications such as drug delivery and sensor development. Additionally, B-(2,3,6-Trichlorophenyl)boronic acid may exhibit biological activity, making it of interest in medicinal chemistry. Safety precautions should be taken when handling this compound, as with many organoboron compounds, due to potential toxicity and environmental impact.

Formula: C₆H₄BCl₃O₂

InChI: InChI=1S/C6H4BCl3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2,11-12H

InChI key: InChIKey=AOPIKELJCFCNCK-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C(Cl)C(Cl)=CC=C1Cl

Synonyms:

• (2,3,6-Trichlorophenyl)boronic acid
• B-(2,3,6-Trichlorophenyl)boronic acid
• Boronic acid, B-(2,3,6-trichlorophenyl)-
• Boronic acid, (2,3,6-trichlorophenyl)-

(2,3,6-trichlorophenyl)boronic acid

CAS: 851756-53-1

Formula: C₆H₄BCl₃O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 225.2648

Ref: IN-DA01B3X1

2,3,6-Trichlorophenylboronic acid

CAS: 851756-53-1

Purity: ≥95%

Molecular weight: 225.2599945

Ref: 10-F627083

(2,3,6-Trichlorophenyl)boronic acid

CAS: 851756-53-1

Versatile small molecule scaffold

Formula: C₆H₄BCl₃O₂

Purity: Min. 95%

Molecular weight: 225.3 g/mol

Ref: 3D-BJB75653