CAS 851759-19-8

3-pyridinecarboxylic acid, 6-chloro-2-methyl-, methyl ester

Description:

3-Pyridinecarboxylic acid, 6-chloro-2-methyl-, methyl ester, also known by its CAS number 851759-19-8, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group that has been esterified with methanol, resulting in a methyl ester. The presence of a chlorine atom at the 6-position and a methyl group at the 2-position of the pyridine ring contributes to its unique chemical properties and reactivity. Typically, such compounds exhibit moderate solubility in polar solvents due to the polar nature of the ester and carboxylic acid groups. They may also participate in various chemical reactions, including nucleophilic substitutions and ester hydrolysis. The compound's structure suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis, although specific applications would depend on further research and development. Safety data should be consulted for handling and usage, as with all chemical substances.

Formula: C₈H₈ClNO₂

InChI: InChI=1/C8H8ClNO2/c1-5-6(8(11)12-2)3-4-7(9)10-5/h3-4H,1-2H3

SMILES: Cc1c(ccc(Cl)n1)C(=O)OC

Synonyms:

• Methyl 6-chloro-2-methylnicotinate

Methyl 6-chloro-2-methylnicotinate

CAS: 851759-19-8

Formula: C₈H₈ClNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 185.6076

Ref: IN-DA00GA45

Methyl 6-chloro-2-methylnicotinate

CAS: 851759-19-8

Methyl 6-chloro-2-methylnicotinate

Purity: 99%

Color and Shape: Solid

Molecular weight: 185.61g/mol

Ref: 54-OR55099

METHYL 6-CHLORO-2-METHYLPYRIDINE-3-CARBOXYLATE

CAS: 851759-19-8

Formula: C₈H₈ClNO₂

Purity: 97%

Molecular weight: 185.61

Ref: 10-F538545

Methyl 6-chloro-2-methylnicotinate

CAS: 851759-19-8

Versatile small molecule scaffold

Formula: C₈H₈ClNO₂

Purity: Min. 95%

Molecular weight: 185.61 g/mol

Ref: 3D-BJB75919