CAS 851768-62-2
:8'-iminospiro[1,3-dihydroperimidine-2,7'-naphthalene]-1'-amine
Description:
8'-Iminospiro[1,3-dihydroperimidine-2,7'-naphthalene]-1'-amine is a complex organic compound characterized by its unique structural features, which include a spirocyclic framework that combines elements of perimidine and naphthalene. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and the ability to participate in various chemical reactions due to the presence of nitrogen atoms in its structure. The imino group contributes to its reactivity, making it a candidate for further chemical modifications or applications in medicinal chemistry. Additionally, the naphthalene moiety may impart aromatic characteristics, influencing its solubility and interaction with other molecules. The compound's specific properties, such as melting point, solubility, and spectral characteristics, would depend on its purity and the conditions under which it is studied. Overall, 8'-iminospiro[1,3-dihydroperimidine-2,7'-naphthalene]-1'-amine represents a fascinating subject for research in organic synthesis and pharmacology.
Formula:C20H16N4
InChI:InChI=1/C20H16N4/c21-14-7-1-4-13-10-11-20(19(22)17(13)14)23-15-8-2-5-12-6-3-9-16(24-20)18(12)15/h1-11,22-24H,21H2
SMILES:c1cc2C=CC3(C(=N)c2c(c1)N)Nc1cccc2cccc(c12)N3
Synonyms:- 1-Imino-1H,1'H,3'H-spiro[naphthalene-2,2'-perimidin]-8-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,3-Dihydro-2-spiro-7-[8-imino-7,8-dihydronaphthalen-1-amine]perimidine ,
CAS:Formula:C20H16N4Color and Shape:SolidMolecular weight:312.3678

