CAS 851768-63-3
:8'-aminospiro[1,3-dihydroperimidine-2,4'-naphthalene]-1'-one
Description:
8'-Aminospiro[1,3-dihydroperimidine-2,4'-naphthalene]-1'-one is a chemical compound characterized by its unique spirocyclic structure, which combines a perimidine moiety with a naphthalene derivative. This compound features an amine functional group, which can influence its reactivity and potential applications in medicinal chemistry. The presence of the spiro linkage contributes to its three-dimensional conformation, potentially affecting its biological activity and interaction with biological targets. The compound may exhibit properties such as fluorescence or specific binding affinities, making it of interest in drug discovery and development. Its CAS number, 851768-63-3, allows for easy identification in chemical databases and literature. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, this compound represents a class of molecules that may have significant implications in pharmacology and materials science.
Formula:C20H15N3O
InChI:InChI=1/C20H15N3O/c21-14-7-3-6-13-19(14)17(24)10-11-20(13)22-15-8-1-4-12-5-2-9-16(23-20)18(12)15/h1-11,22-23H,21H2
SMILES:c1cc2cccc3c2c(c1)NC1(C=CC(=O)c2c1cccc2N)N3
Synonyms:- 5-Amino-1'H,3'H,4H-spiro[naphthalene-1,2'-perimidin]-4-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,3-Dihydro-2-spiro-4'-[8'-aminonaphthalen-1'(4'H)-one]perimidine (contains o-form)
CAS:Formula:C20H15N3OColor and Shape:SolidMolecular weight:313.3526

