CAS 85178-37-6
:5-Thioxo-L-proline methyl ester
Description:
5-Thioxo-L-proline methyl ester, with the CAS number 85178-37-6, is a chemical compound that belongs to the class of thiazolidine derivatives. This substance features a thioxo group, which contributes to its unique reactivity and potential biological activity. It is characterized by the presence of a proline backbone, which is an amino acid known for its role in protein structure and function. The methyl ester functional group enhances its solubility in organic solvents and may influence its pharmacokinetic properties. This compound is of interest in medicinal chemistry and biochemistry due to its potential applications in drug development and as a building block for synthesizing more complex molecules. Its properties, such as melting point, solubility, and stability, can vary depending on environmental conditions and the presence of other chemical entities. As with many thiazolidine derivatives, it may exhibit biological activities, including antimicrobial or antioxidant effects, making it a subject of research in various scientific fields.
Formula:C6H9NO2S
InChI:InChI=1S/C6H9NO2S/c1-9-6(8)4-2-3-5(10)7-4/h4H,2-3H2,1H3,(H,7,10)/t4-/m0/s1
InChI key:InChIKey=BDNFWMHPTDPFIT-BYPYZUCNSA-N
SMILES:C(OC)(=O)[C@H]1NC(=S)CC1
Synonyms:- (S)-Methyl 5-thioxopyrrolidine-2-carboxylate
- 5-Thioxo-<span class="text-smallcaps">L</span>-proline methyl ester
- <span class="text-smallcaps">L</span>-Proline, 5-thioxo-, methyl ester
- methyl (2S)-5-thioxopyrrolidine-2-carboxylate
- Methyl 5-thioxo-L-prolinate
- L-Proline, 5-thioxo-, methyl ester
- 5-Thioxo-L-proline methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(S)-Methyl 5-thioxopyrrolidine-2-carboxylate
CAS:<p>Methyl 5-thioxopyrrolidine-2-carboxylate is a versatile building block that can be used in the synthesis of complex compounds. It is a reagent and speciality chemical, which can be used to synthesize a variety of different compounds. This compound has been shown to be useful as a reaction component or scaffold in the synthesis of pharmaceuticals and other chemicals. Methyl 5-thioxopyrrolidine-2-carboxylate also has high quality and is a useful intermediate in the production of other chemicals. The CAS number for this compound is 85178-37-6.</p>Formula:C6H9NO2SPurity:Min. 95%Molecular weight:159.21 g/mol
