CAS 851788-20-0
:Acetamide, 2-chloro-N-[(4-ethoxyphenyl)methyl]-N-methyl-
Description:
Acetamide, 2-chloro-N-[(4-ethoxyphenyl)methyl]-N-methyl- is an organic compound characterized by its amide functional group, which is derived from acetic acid. The presence of a chloro substituent indicates that it has a chlorine atom attached to the carbon chain, which can influence its reactivity and solubility. The compound also features a 4-ethoxyphenyl group, suggesting that it has an aromatic structure with an ethoxy substituent, contributing to its hydrophobic characteristics. The N-methyl group indicates that one of the nitrogen's hydrogen atoms is replaced by a methyl group, which can affect the compound's steric and electronic properties. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential interactions with biological targets, and its solubility profile may vary depending on the solvent used. Overall, the unique combination of functional groups in this compound contributes to its potential applications in various fields, including medicinal chemistry and material science.
Formula:C12H16ClNO2
InChI:InChI=1S/C12H16ClNO2/c1-3-16-11-6-4-10(5-7-11)9-14(2)12(15)8-13/h4-7H,3,8-9H2,1-2H3
InChI key:InChIKey=WENQZSFKNAKBRC-UHFFFAOYSA-N
SMILES:C(N(C(CCl)=O)C)C1=CC=C(OCC)C=C1
Synonyms:- Acetamide, 2-chloro-N-[(4-ethoxyphenyl)methyl]-N-methyl-
- 2-Chloro-N-[(4-ethoxyphenyl)methyl]-N-methylacetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.