CAS 851814-14-7
:Ethyl 2-(4-methylphenyl)-α-oxoimidazo[1,2-a]pyridine-3-acetate
Description:
Ethyl 2-(4-methylphenyl)-α-oxoimidazo[1,2-a]pyridine-3-acetate is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine core fused with an α-oxo group and an ethyl acetate moiety. This compound features a 4-methylphenyl substituent, contributing to its aromatic character and potentially influencing its reactivity and solubility. The presence of the α-oxo group suggests that it may participate in various chemical reactions, such as condensation or nucleophilic attacks, making it of interest in synthetic organic chemistry. Additionally, the ethyl acetate group may enhance its lipophilicity, affecting its biological activity and interaction with other molecules. The compound's unique structure may also confer specific pharmacological properties, making it a candidate for further research in medicinal chemistry. Overall, Ethyl 2-(4-methylphenyl)-α-oxoimidazo[1,2-a]pyridine-3-acetate exemplifies the diversity of organic compounds and their potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C18H16N2O3
InChI:InChI=1S/C18H16N2O3/c1-3-23-18(22)17(21)16-15(13-9-7-12(2)8-10-13)19-14-6-4-5-11-20(14)16/h4-11H,3H2,1-2H3
InChI key:InChIKey=YWOUBJPQERHRGI-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)(=O)C1=C(N=C2N1C=CC=C2)C3=CC=C(C)C=C3
Synonyms:- Ethyl 2-(4-methylphenyl)-α-oxoimidazo[1,2-a]pyridine-3-acetate
- Imidazo[1,2-a]pyridine-3-acetic acid, 2-(4-methylphenyl)-α-oxo-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.