CymitQuimica logo

CAS 85187-19-5

:

Silicic acid (H4SiO4), tetrakis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] ester

Description:
Silicic acid (H4SiO4), tetrakis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] ester, identified by CAS number 85187-19-5, is a silicate compound characterized by its complex structure that includes multiple ethoxy groups. This compound is a derivative of silicic acid, which is known for its role in various chemical processes, particularly in the formation of silicate materials. The presence of methoxyethoxy groups enhances its solubility and reactivity, making it useful in applications such as coatings, adhesives, and as a precursor in the synthesis of silica-based materials. The esterification of silicic acid with ethoxy groups typically results in improved stability and functionality, allowing for better integration into polymer matrices. Additionally, this compound may exhibit properties such as low volatility and high thermal stability, which are advantageous in industrial applications. However, specific physical and chemical properties, such as melting point, boiling point, and solubility, would need to be referenced from detailed material safety data sheets or chemical databases for precise information.
Formula:C28H60O16Si
InChI:InChI=1S/C28H60O16Si/c1-29-5-9-33-13-17-37-21-25-41-45(42-26-22-38-18-14-34-10-6-30-2,43-27-23-39-19-15-35-11-7-31-3)44-28-24-40-20-16-36-12-8-32-4/h5-28H2,1-4H3
InChI key:InChIKey=DYBLTIAFXZBWPG-UHFFFAOYSA-N
SMILES:[Si](OCCOCCOCCOC)(OCCOCCOCCOC)(OCCOCCOCCOC)OCCOCCOCCOC
Synonyms:
  • Tetrakis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]silane
  • Silicic acid (H4SiO4), tetrakis[2-[2-(2-methoxyethoxy)ethoxy]ethyl] ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.