CAS 851879-27-1
:2-(2,3-Dimethoxyphenyl)-4-thiazoleacetic acid
Description:
2-(2,3-Dimethoxyphenyl)-4-thiazoleacetic acid is a chemical compound characterized by its unique structural features, which include a thiazole ring and a phenyl group with two methoxy substituents. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the thiazole moiety may contribute to its reactivity and interaction with biological targets, making it of interest in medicinal chemistry. The methoxy groups can influence the compound's electronic properties and steric hindrance, potentially affecting its pharmacokinetics and pharmacodynamics. Additionally, the carboxylic acid functional group in the structure may impart acidic characteristics, allowing for ionization under certain pH conditions. Overall, 2-(2,3-Dimethoxyphenyl)-4-thiazoleacetic acid is a compound of interest for further research, particularly in the fields of drug development and organic synthesis, due to its complex structure and potential applications.
Formula:C13H13NO4S
InChI:InChI=1S/C13H13NO4S/c1-17-10-5-3-4-9(12(10)18-2)13-14-8(7-19-13)6-11(15)16/h3-5,7H,6H2,1-2H3,(H,15,16)
InChI key:InChIKey=SJLSXSKURJTDII-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC=C1OC)C2=NC(CC(O)=O)=CS2
Synonyms:- 4-Thiazoleacetic acid, 2-(2,3-dimethoxyphenyl)-
- 2-(2,3-Dimethoxyphenyl)-4-thiazoleacetic acid
- [2-(2,3-Dimethoxyphenyl)-1,3-thiazol-4-yl]acetic acid
- 2-[2-(2,3-Dimethoxyphenyl)-1,3-thiazol-4-yl]acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.