CAS 851879-28-2
:1-(3-Chloro-2-methylphenyl)-1,3-dihydro-2H-imidazole-2-thione
Description:
1-(3-Chloro-2-methylphenyl)-1,3-dihydro-2H-imidazole-2-thione, identified by its CAS number 851879-28-2, is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing nitrogen atoms. This substance features a chloro-substituted aromatic ring, contributing to its potential reactivity and biological activity. The presence of the thione functional group (–C=S) indicates that it may exhibit properties similar to thiols, such as acting as a nucleophile or participating in redox reactions. The compound's molecular structure suggests it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and heterocyclic components. Additionally, the chlorine atom may influence its solubility and interaction with biological targets. Overall, this compound's unique structural features make it a subject of interest for further research in various chemical and biological contexts.
Formula:C10H9ClN2S
InChI:InChI=1S/C10H9ClN2S/c1-7-8(11)3-2-4-9(7)13-6-5-12-10(13)14/h2-6H,1H3,(H,12,14)
InChI key:InChIKey=DBXRSCUPUYBYOK-UHFFFAOYSA-N
SMILES:S=C1N(C=CN1)C2=C(C)C(Cl)=CC=C2
Synonyms:- 2H-Imidazole-2-thione, 1-(3-chloro-2-methylphenyl)-1,3-dihydro-
- 1-(3-Chloro-2-methylphenyl)-1,3-dihydro-2H-imidazole-2-thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.