CymitQuimica logo

CAS 851882-57-0

:

3-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidine

Description:
3-(3-Phenyl-1,2,4-oxadiazol-5-yl)piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and a 1,2,4-oxadiazole moiety substituted with a phenyl group. The presence of the oxadiazole ring contributes to its potential as a bioactive molecule, often associated with various pharmacological activities, including antimicrobial and anti-inflammatory properties. The piperidine ring enhances the compound's ability to interact with biological targets, making it of interest in medicinal chemistry. This compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure allows for potential interactions through hydrogen bonding and π-π stacking due to the aromatic phenyl group. The compound's properties, such as melting point, boiling point, and reactivity, can vary based on its purity and the conditions under which it is handled. Overall, 3-(3-phenyl-1,2,4-oxadiazol-5-yl)piperidine represents a class of compounds that may have significant implications in drug development and material science.
Formula:C13H15N3O
InChI:InChI=1/C13H15N3O/c1-2-5-10(6-3-1)12-15-13(17-16-12)11-7-4-8-14-9-11/h1-3,5-6,11,14H,4,7-9H2
SMILES:c1ccc(cc1)c1nc(C2CCCNC2)on1
Synonyms:
  • Piperidine, 3-(3-Phenyl-1,2,4-Oxadiazol-5-Yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.