CymitQuimica logo

CAS 851903-42-9

:

3-[4-[(3,5-Dimethyl-4-isoxazolyl)methoxy]-3-methoxyphenyl]-2-propenoic acid

Description:
3-[4-[(3,5-Dimethyl-4-isoxazolyl)methoxy]-3-methoxyphenyl]-2-propenoic acid, identified by its CAS number 851903-42-9, is a synthetic organic compound characterized by its complex structure, which includes an isoxazole ring and multiple methoxy groups. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the isoxazole moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The propenoic acid functional group indicates that it may participate in various chemical reactions, such as polymerization or esterification. Additionally, the compound's solubility and stability can be influenced by the methoxy substituents, which may enhance its lipophilicity. Overall, this compound's unique structural features may confer specific pharmacological properties, warranting further investigation for potential applications in drug development or other fields of chemistry.
Formula:C16H17NO5
InChI:InChI=1S/C16H17NO5/c1-10-13(11(2)22-17-10)9-21-14-6-4-12(5-7-16(18)19)8-15(14)20-3/h4-8H,9H2,1-3H3,(H,18,19)
InChI key:InChIKey=AGHIZDYJLUTOLB-UHFFFAOYSA-N
SMILES:O(CC=1C(C)=NOC1C)C2=C(OC)C=C(C=CC(O)=O)C=C2
Synonyms:
  • 2-Propenoic acid, 3-[4-[(3,5-dimethyl-4-isoxazolyl)methoxy]-3-methoxyphenyl]-
  • 3-[4-[(3,5-Dimethyl-4-isoxazolyl)methoxy]-3-methoxyphenyl]-2-propenoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.