CAS 851903-52-1

N-[(5-Bromo-2-thienyl)methyl]-2-chloro-N-ethylacetamide

Description:

N-[(5-Bromo-2-thienyl)methyl]-2-chloro-N-ethylacetamide is a chemical compound characterized by its unique structural features, which include a thienyl ring and a chloroacetamide moiety. The presence of the bromine atom on the thienyl ring enhances its reactivity and may influence its biological activity. This compound is likely to exhibit moderate to high lipophilicity due to the ethyl and thienyl groups, which can affect its solubility in organic solvents. The chloro group introduces additional reactivity, potentially allowing for further chemical modifications. As an acetamide derivative, it may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can influence its interaction with biological targets. The compound's specific applications and biological activities would depend on its interaction with various receptors or enzymes, making it of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed, as with any chemical substance, particularly those containing halogens and reactive functional groups.

Formula: C₉H₁₁BrClNOS

InChI: InChI=1S/C9H11BrClNOS/c1-2-12(9(13)5-11)6-7-3-4-8(10)14-7/h3-4H,2,5-6H2,1H3

InChI key: InChIKey=NLZAEWWOYAJKCZ-UHFFFAOYSA-N

SMILES: C(N(C(CCl)=O)CC)C1=CC=C(Br)S1

Synonyms:

• N-[(5-Bromo-2-thienyl)methyl]-2-chloro-N-ethylacetamide
• Acetamide, N-[(5-bromo-2-thienyl)methyl]-2-chloro-N-ethyl-