CAS 85196-34-5
:Ethyl 2-(2-methyl-4,6-dinitrophenoxy)acetate
Description:
Ethyl 2-(2-methyl-4,6-dinitrophenoxy)acetate, with the CAS number 85196-34-5, is an organic compound characterized by its ester functional group and a complex aromatic structure. This compound features a dinitrophenoxy moiety, which contributes to its potential reactivity and biological activity. Typically, compounds of this nature are known for their applications in various fields, including pharmaceuticals and agrochemicals, due to their ability to interact with biological systems. Ethyl 2-(2-methyl-4,6-dinitrophenoxy)acetate may exhibit properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many esters. Its molecular structure suggests potential for electrophilic substitution reactions, particularly due to the presence of the electron-withdrawing nitro groups. Safety data would indicate that, like many dinitro compounds, it may pose hazards such as toxicity or environmental concerns, necessitating careful handling and disposal. Overall, this compound exemplifies the diverse chemistry associated with substituted aromatic esters.
Formula:C11H12N2O7
InChI:InChI=1S/C11H12N2O7/c1-3-19-10(14)6-20-11-7(2)4-8(12(15)16)5-9(11)13(17)18/h4-5H,3,6H2,1-2H3
InChI key:InChIKey=FLYTYTLSOFMQGG-UHFFFAOYSA-N
SMILES:O(CC(OCC)=O)C1=C(N(=O)=O)C=C(N(=O)=O)C=C1C
Synonyms:- Ethyl 2-(2-methyl-4,6-dinitrophenoxy)acetate
- Acetic acid, (4,6-dinitro-o-tolyloxy)-, ethyl ester
- Acetic acid, 2-(2-methyl-4,6-dinitrophenoxy)-, ethyl ester
- Acetic acid, (2-methyl-4,6-dinitrophenoxy)-, ethyl ester
- (2-Methyl-4,6-dinitro-phenoxy)-acetic acid ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.