CAS 851962-00-0

14-(2-Pyridinyldithio)-3,6,9,12-tetraoxatetradecan-1-ol

Description:

14-(2-Pyridinyldithio)-3,6,9,12-tetraoxatetradecan-1-ol is a complex organic compound characterized by its unique structure, which includes a long carbon chain and multiple functional groups. The presence of a pyridinyldithio moiety suggests that it has potential applications in coordination chemistry and as a ligand due to the ability of the nitrogen atom in the pyridine ring to coordinate with metal ions. The tetraoxatetradecan backbone indicates that the compound contains several ether linkages, which may contribute to its solubility and reactivity. Additionally, the hydroxyl group at one end of the molecule can participate in hydrogen bonding, influencing its physical properties such as melting point and solubility in various solvents. This compound may exhibit interesting biological activities or serve as a precursor in the synthesis of more complex molecules. Its specific applications would depend on further studies exploring its reactivity and interactions with other chemical species. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential utility in various fields.

Formula: C₁₅H₂₅NO₅S₂

InChI: InChI=1S/C15H25NO5S2/c17-5-6-18-7-8-19-9-10-20-11-12-21-13-14-22-23-15-3-1-2-4-16-15/h1-4,17H,5-14H2

InChI key: InChIKey=SRJNWCKJRBPYNE-UHFFFAOYSA-N

SMILES: S(SCCOCCOCCOCCOCCO)C1=CC=CC=N1

Synonyms:

• 3,6,9,12-Tetraoxatetradecan-1-ol, 14-(2-pyridinyldithio)-
• 14-(2-Pyridinyldithio)-3,6,9,12-tetraoxatetradecan-1-ol

3,6,9,12-Tetraoxatetradecan-1-ol, 14-(2-pyridinyldithio)-

CAS: 851962-00-0

Formula: C₁₅H₂₅NO₅S₂

Molecular weight: 363.4927

Ref: IN-DA01OU7X