CAS 852030-98-9

4-(4-Phenyl-1H-1,2,3-triazol-1-yl)piperidine hydrochloride

Description:

4-(4-Phenyl-1H-1,2,3-triazol-1-yl)piperidine hydrochloride is a chemical compound characterized by its unique structure, which includes a piperidine ring and a triazole moiety. The presence of the triazole ring contributes to its potential biological activity, as triazoles are known for their role in medicinal chemistry, particularly as antifungal agents and in other therapeutic applications. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water, making it suitable for various laboratory and pharmaceutical applications. The molecular structure allows for potential interactions with biological targets, making it of interest in drug discovery and development. Additionally, the phenyl group attached to the triazole can influence the compound's lipophilicity and overall pharmacokinetic properties. As with many organic compounds, proper handling and storage are essential to maintain stability and prevent degradation. Safety data sheets should be consulted for information on toxicity and safe handling practices.

Formula: C₁₃H₁₇ClN₄

InChI: InChI=1/C13H16N4.ClH/c1-2-4-11(5-3-1)13-10-17(16-15-13)12-6-8-14-9-7-12;/h1-5,10,12,14H,6-9H2;1H

SMILES: c1ccc(cc1)c1cn(C2CCNCC2)nn1.Cl