
CAS 852033-50-2
:2-Chloro-N-[3-(1,4-dihydro-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)phenyl]acetamide
Description:
2-Chloro-N-[3-(1,4-dihydro-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)phenyl]acetamide, with CAS number 852033-50-2, is a synthetic organic compound characterized by its complex structure, which includes a chloro group, an acetamide moiety, and a thieno[2,3-d]pyrimidine derivative. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the thieno[2,3-d]pyrimidine core suggests possible interactions with biological targets, potentially influencing enzyme activity or receptor binding. Its molecular structure may confer specific pharmacological properties, which could be explored in drug development. Additionally, the compound's stability, reactivity, and interaction with other substances would depend on environmental conditions such as pH and temperature. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its biological activity and therapeutic potential.
Formula:C16H14ClN3O2S
InChI:InChI=1S/C16H14ClN3O2S/c1-8-9(2)23-16-13(8)15(22)19-14(20-16)10-4-3-5-11(6-10)18-12(21)7-17/h3-6H,7H2,1-2H3,(H,18,21)(H,19,20,22)
InChI key:InChIKey=ZTSIIDSSRFPHES-UHFFFAOYSA-N
SMILES:O=C1C2=C(NC(=N1)C3=CC(NC(CCl)=O)=CC=C3)SC(C)=C2C
Synonyms:- Acetamide, 2-chloro-N-[3-(1,4-dihydro-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)phenyl]-
- 2-Chloro-N-[3-(1,4-dihydro-5,6-dimethyl-4-oxothieno[2,3-d]pyrimidin-2-yl)phenyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.