CymitQuimica logo

CAS 852111-48-9

:

6-Bromo-3-fluoro-2-(2-propen-1-yl)phenol

Description:
6-Bromo-3-fluoro-2-(2-propen-1-yl)phenol is an organic compound characterized by its aromatic structure, which includes a phenolic group. The presence of bromine and fluorine substituents on the aromatic ring contributes to its unique reactivity and potential applications in various chemical reactions. The propenyl group attached to the phenol enhances its reactivity, making it a candidate for further functionalization in synthetic organic chemistry. This compound may exhibit interesting biological activities due to its structural features, which can influence its interaction with biological targets. Additionally, the presence of halogens like bromine and fluorine can affect the compound's physical properties, such as solubility and stability. As with many halogenated compounds, it is essential to consider environmental and safety aspects during handling and disposal. Overall, 6-Bromo-3-fluoro-2-(2-propen-1-yl)phenol represents a versatile building block in the synthesis of more complex organic molecules.
Formula:C9H8BrFO
InChI:InChI=1S/C9H8BrFO/c1-2-3-6-8(11)5-4-7(10)9(6)12/h2,4-5,12H,1,3H2
InChI key:InChIKey=RBWZIQUVEBDQIP-UHFFFAOYSA-N
SMILES:C(C=C)C1=C(O)C(Br)=CC=C1F
Synonyms:
  • Phenol, 6-bromo-3-fluoro-2-(2-propen-1-yl)-
  • 6-Bromo-3-fluoro-2-(2-propen-1-yl)phenol
  • 2-Allyl-6-bromo-3-fluorophenol
  • Phenol, 6-bromo-3-fluoro-2-(2-propenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.