CAS 852138-90-0
:2,7-Dibromo-9,9-dihexyl-9H-9-silafluorene
Description:
2,7-Dibromo-9,9-dihexyl-9H-9-silafluorene is an organosilicon compound characterized by its unique structure, which includes a silafluorene backbone substituted with bromine and hexyl groups. This compound typically exhibits properties such as good thermal stability and solubility in organic solvents, making it suitable for various applications in organic electronics, particularly in light-emitting diodes (OLEDs) and photovoltaic devices. The presence of bromine atoms enhances its reactivity, allowing for further functionalization, while the hexyl chains contribute to its solubility and processability. Additionally, the silafluorene structure imparts interesting optical properties, including fluorescence, which can be tuned by modifying the substituents. Overall, 2,7-Dibromo-9,9-dihexyl-9H-9-silafluorene is a versatile compound with potential applications in advanced materials science and organic semiconductor technology.
Formula:C24H32Br2Si
InChI:InChI=1S/C24H32Br2Si/c1-3-5-7-9-15-27(16-10-8-6-4-2)23-17-19(25)11-13-21(23)22-14-12-20(26)18-24(22)27/h11-14,17-18H,3-10,15-16H2,1-2H3
InChI key:InChIKey=GNCCMCWBSKYLLL-UHFFFAOYSA-N
SMILES:C(CCCCC)[Si]1(CCCCCC)C=2C(C=3C1=CC(Br)=CC3)=CC=C(Br)C2
Synonyms:- 2,7-Dibromo-9,9-dihexyl-9H-9-silafluorene
- 2,7-Dibromo-9,9′-dihexyl-9H-9-dibenzosilole
- 3,7-Dibromo-5,5-dihexylbenzo[b][1]benzosilole
- 9H-9-Silafluorene, 2,7-dibromo-9,9-dihexyl-
- K0095
- 3,7-Dibromo-5,5-dihexyl-5H-dibenzo[b,d]silole
- 2,7-Dibromo-9,9'-dihexyl-9H-9-dibenzosilane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
