CAS 852138-91-1
:9,9-Dihexyl-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-9-silafluorene
Description:
9,9-Dihexyl-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-9-silafluorene is a complex organic compound characterized by its unique structure, which includes a silafluorene core substituted with hexyl groups and dioxaborolane moieties. This compound is notable for its potential applications in organic electronics, particularly in organic light-emitting diodes (OLEDs) and organic photovoltaics (OPVs), due to its favorable electronic properties and stability. The presence of the dioxaborolane groups enhances its ability to participate in cross-coupling reactions, making it useful in synthetic organic chemistry. Additionally, the hexyl substituents contribute to its solubility in organic solvents, facilitating processing and integration into various materials. The compound's molecular structure also suggests interesting photophysical properties, which can be exploited in optoelectronic applications. Overall, 9,9-Dihexyl-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-9-silafluorene represents a significant advancement in the field of functional organic materials.
Formula:C36H56B2O4Si
InChI:InChI=1S/C36H56B2O4Si/c1-11-13-15-17-23-43(24-18-16-14-12-2)31-25-27(37-39-33(3,4)34(5,6)40-37)19-21-29(31)30-22-20-28(26-32(30)43)38-41-35(7,8)36(9,10)42-38/h19-22,25-26H,11-18,23-24H2,1-10H3
InChI key:InChIKey=LROKIACOFVFLQY-UHFFFAOYSA-N
SMILES:C(CCCCC)[Si]1(CCCCCC)C=2C(C=3C1=CC(=CC3)B4OC(C)(C)C(C)(C)O4)=CC=C(C2)B5OC(C)(C)C(C)(C)O5
Synonyms:- 9,9-Dihexyl-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-9-silafluorene
- 9H-9-Silafluorene, 9,9-dihexyl-2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 2,7-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-yl)-9,9-dihexyl-9H-9-dibenzosilole
- 5,5-Dihexyl-3,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5H-dibenzo[b,d]silole
- 9,9-Dihexyl-9H-9-silafluorene-2,7-bis(boronic acid pinacol ester)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,7-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-yl)-9,9-dihexyl-9H-9-dibenzosilole
CAS:Formula:C36H56B2O4SiMolecular weight:602.5349
