CAS 852146-73-7

N-(diaminomethylidene)-5-(5-fluoro-2-methylphenyl)furan-2-carboxamide

Description:

N-(diaminomethylidene)-5-(5-fluoro-2-methylphenyl)furan-2-carboxamide, with the CAS number 852146-73-7, is a synthetic organic compound characterized by its complex molecular structure, which includes a furan ring, an amide functional group, and a fluorinated aromatic substituent. This compound typically exhibits properties associated with both amides and heterocycles, such as moderate solubility in polar solvents and potential biological activity due to its structural motifs. The presence of the diaminomethylidene group suggests the potential for hydrogen bonding and reactivity, making it of interest in medicinal chemistry and drug development. The fluorine atom in the aromatic ring may enhance lipophilicity and metabolic stability, which are desirable traits in pharmaceutical applications. Overall, this compound's unique structure may contribute to its potential efficacy in various biological systems, warranting further investigation into its pharmacological properties and applications.

Formula: C₁₃H₁₂FN₃O₂

InChI: InChI=1/C13H12FN3O2/c1-7-2-3-8(14)6-9(7)10-4-5-11(19-10)12(18)17-13(15)16/h2-6H,1H3,(H4,15,16,17,18)

SMILES: Cc1ccc(cc1c1ccc(C(=O)NC(=N)N)o1)F

Synonyms:

• KR-32568 >=98% (HPLC), solid
• 2-Furancarboxamide, N-(aminoiminomethyl)-5-(5-fluoro-2-methylphenyl)-
• KR 32568,KR32568

KR-32568

CAS: 852146-73-7

KR-32568

Purity: ≥98%

Molecular weight: 261.25g/mol

Ref: 54-BUP15179

KR-32568

CAS: 852146-73-7

Formula: C₁₃H₁₂FN₃O₂

Molecular weight: 261.25

Ref: 7W-GL1306

KR-32568

CAS: 852146-73-7

KR-32568 is a sodium/hydrogen exchanger 1 (NHE-1) inhibitor (IC50: 230 nM).

Formula: C₁₃H₁₂FN₃O₂

Purity: 99.91%

Color and Shape: Solid

Molecular weight: 261.25

Ref: TM-T36569