CAS 852160-02-2
:1,2,3,5-Tetrahydro-6-methyl-4-phenyl-s-indacene
Description:
1,2,3,5-Tetrahydro-6-methyl-4-phenyl-s-indacene, identified by its CAS number 852160-02-2, is an organic compound characterized by its unique bicyclic structure, which includes both a phenyl group and a tetrahydroindacene framework. This compound typically exhibits properties associated with polycyclic aromatic hydrocarbons, such as potential fluorescence and stability under certain conditions. Its molecular structure suggests it may possess interesting electronic properties, making it a candidate for applications in organic electronics, such as organic light-emitting diodes (OLEDs) or organic photovoltaics. The presence of the methyl and phenyl substituents can influence its solubility, reactivity, and overall stability. Additionally, the compound's stereochemistry may play a significant role in its physical properties and interactions with other molecules. As with many organic compounds, its behavior in various solvents and under different environmental conditions can vary, making it essential to consider these factors in practical applications.
Formula:C19H18
InChI:InChI=1/C19H18/c1-13-10-16-12-15-8-5-9-17(15)19(18(16)11-13)14-6-3-2-4-7-14/h2-4,6-7,10,12H,5,8-9,11H2,1H3
Synonyms:- 6-methyl-4-phenyl-1,2,3,5-tetrahydros-indacene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
