CAS 852180-43-9

N-methyl-1-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]methanamine

Description:

N-methyl-1-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]methanamine, with the CAS number 852180-43-9, is a chemical compound characterized by its complex structure, which includes a thiazole ring and an amine group. This compound typically exhibits properties associated with organic amines, such as basicity due to the presence of the amine functional group. The thiazole moiety contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. The presence of the methyl group on the thiazole ring may influence its lipophilicity and solubility in organic solvents. Additionally, the phenyl group attached to the thiazole can enhance interactions with biological targets, making this compound of interest in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be evaluated for its potential applications in drug development or as a research tool in biochemical studies. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₂H₁₄N₂S

InChI: InChI=1/C12H14N2S/c1-9-14-12(8-15-9)11-5-3-4-10(6-11)7-13-2/h3-6,8,13H,7H2,1-2H3

SMILES: Cc1nc(cs1)c1cccc(c1)CNC

Synonyms:

• N-methyl-N-[3-(2-methyl-1,3-thiazol-4-yl)benzyl]amine

N-Methyl-1-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]methylamine

CAS: 852180-43-9

N-Methyl-1-[3-(2-methyl-1,3-thiazol-4-yl)phenyl]methylamine

Purity: 95%

Molecular weight: 218.32g/mol

Ref: 54-OR4361