CymitQuimica logo

CAS 852180-65-5

:

2-(2-Thienyl)benzenemethanamine

Description:
2-(2-Thienyl)benzenemethanamine, identified by its CAS number 852180-65-5, is an organic compound characterized by the presence of both a thienyl group and a benzylamine structure. The thienyl group, derived from thiophene, contributes to the compound's aromatic properties and potential reactivity due to the sulfur atom in the ring. This compound typically exhibits a moderate to high degree of lipophilicity, which can influence its solubility in organic solvents and its interaction with biological systems. The amine functional group in the benzylamine portion can participate in hydrogen bonding, making it a potential candidate for various chemical reactions, including alkylation and acylation. Additionally, the presence of both aromatic and heteroaromatic systems may impart unique electronic properties, making it of interest in medicinal chemistry and materials science. Overall, 2-(2-Thienyl)benzenemethanamine's structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways.
Formula:C11H11NS
InChI:InChI=1S/C11H11NS/c12-8-9-4-1-2-5-10(9)11-6-3-7-13-11/h1-7H,8,12H2
InChI key:InChIKey=XKOHWVPLVRXZHX-UHFFFAOYSA-N
SMILES:C(N)C1=C(C=CC=C1)C2=CC=CS2
Synonyms:
  • Benzenemethanamine, 2-(2-thienyl)-
  • (2-Thiophen-2-ylphenyl)methanamine
  • 2-(2-Thienyl)benzenemethanamine
  • 2-(Thien-2-yl)benzylamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.