CAS 852180-77-9

N-methyl-1-[4-(2-morpholin-4-ylethoxy)phenyl]methanamine

Description:

N-methyl-1-[4-(2-morpholin-4-ylethoxy)phenyl]methanamine, identified by its CAS number 852180-77-9, is a chemical compound characterized by its complex structure, which includes a methanamine core substituted with a morpholine group and an ethoxyphenyl moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the morpholine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, the ethoxy group may enhance lipophilicity, affecting the compound's pharmacokinetics. Overall, this compound's unique structural features contribute to its potential utility in various chemical and biological applications, although specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise determination.

Formula: C₁₄H₂₂N₂O₂

InChI: InChI=1/C14H22N2O2/c1-15-12-13-2-4-14(5-3-13)18-11-8-16-6-9-17-10-7-16/h2-5,15H,6-12H2,1H3

SMILES: CNCc1ccc(cc1)OCCN1CCOCC1

Synonyms:

• N-methyl-N-[4-(2-morpholin-4-ylethoxy)benzyl]amine

N-Methyl-1-{4-[2-(morpholin-4-yl)ethoxy]phenyl}methylamine

CAS: 852180-77-9

N-Methyl-1-{4-[2-(morpholin-4-yl)ethoxy]phenyl}methylamine

Purity: 95%

Color and Shape: Liquid

Molecular weight: 250.34g/mol

Ref: 54-OR4369