CAS 852181-11-4

2,5-Dibromonicotinaldehyde

Description:

2,5-Dibromonicotinaldehyde is an organic compound that belongs to the class of heterocyclic aromatic aldehydes, specifically a brominated derivative of nicotinaldehyde. It features a pyridine ring with two bromine substituents at the 2 and 5 positions, along with an aldehyde functional group at the 1-position. This compound is characterized by its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to the reactivity of the aldehyde group and the presence of bromine, which can facilitate further chemical transformations. The bromine atoms enhance the compound's electrophilicity, making it useful in various coupling reactions. Additionally, 2,5-Dibromonicotinaldehyde may exhibit biological activity, which warrants investigation for its potential use in medicinal chemistry. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. As with many brominated compounds, safety precautions should be taken due to the potential toxicity of bromine-containing substances.

Formula: C₆H₃Br₂NO

InChI: InChI=1/C6H3Br2NO/c7-5-1-4(3-10)6(8)9-2-5/h1-3H

SMILES: c1c(C=O)c(Br)ncc1Br

Synonyms:

• 2,5-Dibromopyridine-3-carboxaldehyde
• 2,5-Dibromopyridine-3-Carbaldehyde

2,5-Dibromonicotinaldehyde

CAS: 852181-11-4

Formula: C₆H₃Br₂NO

Purity: 95%

Color and Shape: Solid

Molecular weight: 264.9021

Ref: IN-DA004Q97

2,5-Dibromonicotinaldehyde

CAS: 852181-11-4

2,5-Dibromonicotinaldehyde

Purity: 95%

Color and Shape: Powder

Molecular weight: 264.90g/mol

Ref: 54-OR4434

2,5-Dibromonicotinaldehyde

CAS: 852181-11-4

Purity: 97%

Molecular weight: 264.9039917

Ref: 10-F632972