CAS 852181-12-5

Methyl 2-formyl-4H-thieno[3,2-b]pyrrole-5-carboxylate

Description:

Methyl 2-formyl-4H-thieno[3,2-b]pyrrole-5-carboxylate is a heterocyclic organic compound characterized by its unique thieno-pyrrole structure, which incorporates both a thieno and a pyrrole ring. This compound features a formyl group and a carboxylate ester, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the thieno ring enhances its electronic properties, making it a candidate for use in organic electronics and as a building block in the synthesis of more complex molecules. Additionally, the methyl ester group can undergo hydrolysis, making it versatile for further chemical modifications. Its structural complexity and functional groups suggest potential biological activity, which may warrant investigation in pharmacological studies. The compound is typically handled with standard laboratory safety precautions, as with many organic compounds, due to potential reactivity and toxicity. Overall, Methyl 2-formyl-4H-thieno[3,2-b]pyrrole-5-carboxylate represents an interesting subject for research in both synthetic and applied chemistry.

Formula: C₉H₇NO₃S

InChI: InChI=1S/C9H7NO3S/c1-13-9(12)7-3-8-6(10-7)2-5(4-11)14-8/h2-4,10H,1H3

InChI key: InChIKey=PUHJYPWZKYNWFJ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CC2=C(N1)C=C(C=O)S2

Synonyms:

• Methyl 2-formyl-4H-thieno[3,2-b]pyrrole-5-carboxylate
• 4H-Thieno[3,2-b]pyrrole-5-carboxylic acid, 2-formyl-, methyl ester