CAS 85221-17-6

4-acetylphenyl (3,4-dichlorophenyl)carbamate

Description:

4-Acetylphenyl (3,4-dichlorophenyl)carbamate, with the CAS number 85221-17-6, is an organic compound that belongs to the class of carbamates. This substance typically exhibits characteristics such as being a solid at room temperature, with a specific melting point and solubility profile that may vary depending on the solvent used. It is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its biological activity. The presence of both acetyl and dichlorophenyl groups in its structure contributes to its chemical reactivity and interaction with biological systems. The compound may also exhibit moderate to high stability under standard conditions, although it should be handled with care due to potential toxicity associated with carbamate derivatives. As with many organic compounds, proper storage and handling procedures are essential to ensure safety and maintain its integrity for research or industrial use.

Formula: C₁₅H₁₁Cl₂NO₃

InChI: InChI=1/C15H11Cl2NO3/c1-9(19)10-2-5-12(6-3-10)21-15(20)18-11-4-7-13(16)14(17)8-11/h2-8H,1H3,(H,18,20)

SMILES: CC(=O)c1ccc(cc1)OC(=Nc1ccc(c(c1)Cl)Cl)O

Synonyms:

• Carbamic acid, (3,4-dichlorophenyl)-, 4-acetylphenyl ester