
CAS 852217-68-6
:4-(2-Chlorophenyl)-N-(phenylmethyl)-2-thiazolamine
Description:
4-(2-Chlorophenyl)-N-(phenylmethyl)-2-thiazolamine, identified by its CAS number 852217-68-6, is a chemical compound that belongs to the class of thiazole derivatives. This compound features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen atoms. The presence of a 2-chlorophenyl group and a phenylmethyl substituent contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. Thiazole derivatives are often studied for their pharmacological properties, including antimicrobial and anticancer activities. The compound's molecular structure suggests it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.
Formula:C16H13ClN2S
InChI:InChI=1S/C16H13ClN2S/c17-14-9-5-4-8-13(14)15-11-20-16(19-15)18-10-12-6-2-1-3-7-12/h1-9,11H,10H2,(H,18,19)
InChI key:InChIKey=OQNIEFDEMLHYRK-UHFFFAOYSA-N
SMILES:ClC1=C(C=2N=C(NCC3=CC=CC=C3)SC2)C=CC=C1
Synonyms:- 2-Thiazolamine, 4-(2-chlorophenyl)-N-(phenylmethyl)-
- 4-(2-Chlorophenyl)-N-(phenylmethyl)-2-thiazolamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.