CAS 852217-75-5
:2-Chloro-1-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1-pyrrolidinyl]ethanone
Description:
2-Chloro-1-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1-pyrrolidinyl]ethanone, with CAS number 852217-75-5, is a synthetic organic compound characterized by its complex structure, which includes a chloro group, a pyrrolidine ring, and a benzodioxepin moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its structural features, which may interact with biological targets. The presence of the chloro substituent can influence its reactivity and stability, while the pyrrolidine and benzodioxepin components may contribute to its pharmacological properties. Such compounds are often studied for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development. However, specific physical properties like melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise characterization. Safety data should also be consulted to understand handling and toxicity considerations associated with this compound.
Formula:C15H18ClNO3
InChI:InChI=1S/C15H18ClNO3/c16-10-15(18)17-6-1-3-12(17)11-4-5-13-14(9-11)20-8-2-7-19-13/h4-5,9,12H,1-3,6-8,10H2
InChI key:InChIKey=FDEJYVYKKSGDOH-UHFFFAOYSA-N
SMILES:C(CCl)(=O)N1C(CCC1)C=2C=C3C(=CC2)OCCCO3
Synonyms:- Ethanone, 2-chloro-1-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1-pyrrolidinyl]-
- Pyrrolidine, 1-(chloroacetyl)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-
- 2-Chloro-1-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-1-pyrrolidinyl]ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.