CAS 852218-15-6

2-[4-(1,3-Dithiolan-2-yl)phenoxy]acetic acid

Description:

2-[4-(1,3-Dithiolan-2-yl)phenoxy]acetic acid, identified by its CAS number 852218-15-6, is a chemical compound characterized by its unique structure that includes a phenoxy group and a dithiolan moiety. This compound typically exhibits properties associated with both aromatic and sulfur-containing compounds, which may influence its reactivity and interactions. The presence of the dithiolan ring suggests potential for nucleophilic behavior, while the phenoxy group can contribute to its solubility in organic solvents. As an acetic acid derivative, it may also display acidic properties, allowing it to participate in various chemical reactions, including esterification and salt formation. The compound's specific applications and biological activity would depend on its molecular interactions, making it of interest in fields such as medicinal chemistry and materials science. However, detailed studies would be necessary to fully elucidate its characteristics, including its stability, solubility, and potential uses in various chemical contexts.

Formula: C₁₁H₁₂O₃S₂

InChI: InChI=1S/C11H12O3S2/c12-10(13)7-14-9-3-1-8(2-4-9)11-15-5-6-16-11/h1-4,11H,5-7H2,(H,12,13)

InChI key: InChIKey=LQUMXSSIHJIHOE-UHFFFAOYSA-N

SMILES: O(CC(O)=O)C1=CC=C(C=C1)C2SCCS2

Synonyms:

• 2-[4-(1,3-Dithiolan-2-yl)phenoxy]acetic acid
• Acetic acid, [4-(1,3-dithiolan-2-yl)phenoxy]-
• Acetic acid, 2-[4-(1,3-dithiolan-2-yl)phenoxy]-

2-[4-(1,3-Dithiolan-2-yl)phenoxy]acetic acid

CAS: 852218-15-6

Versatile small molecule scaffold

Formula: C₁₁H₁₂O₃S₂

Purity: Min. 95%

Molecular weight: 256.3 g/mol

Ref: 3D-CJB21815